Export Top Purity (R)-(4-hydroxyphenyl)(phenylacetamido)acetic acid 54582-01-3 In Stock We supply high quality (R)-(4-hydroxyphenyl)(phenylacetamido)acetic acid (CAS 54582-01-3), in stock, factory directly supply to clients, lower prices, more competitiveness.
What is the (R)-(4-hydroxyphenyl)(phenylacetamido)acetic acid ?
(R)-(4-hydroxyphenyl)(phenylacetamido)acetic acid is , while it's Molecular Formula is C16H15NO4. Used in Pharmaceutical Industry:
(R)-(4-hydroxyphenyl)(phenylacetamido)acetic acid is used as a potential pharmaceutical compound for its possible pharmacological or biological activities. The presence of phenylacetamido and 4-hydroxyphenyl groups, which are known to be active in various medications, indicates that (R)-(4-hydroxyphenyl)(phenylacetamido)acetic acid could be a promising candidate for the development of new drugs or therapies.
Used in Research and Development:
In the field of chemical research and development, (R)-(4-hydroxyphenyl)(phenylacetamido)acetic acid serves as a valuable compound for studying its properties, interactions, and potential applications. Its chiral nature and the presence of specific functional groups make it an interesting subject for further investigation, which could lead to the discovery of new chemical reactions, synthesis methods, or applications in various industries.
Used in Chemical Synthesis:
(R)-(4-hydroxyphenyl)(phenylacetamido)acetic acid may be utilized as a building block or intermediate in the synthesis of more complex molecules, particularly in the pharmaceutical, agrochemical, or material science industries. Its unique structure and functional groups could be exploited to create novel compounds with specific properties or applications.
What is the CAS number for (R)-(4-hydroxyphenyl)(phenylacetamido)acetic acid ?
The CAS number of (R)-(4-hydroxyphenyl)(phenylacetamido)acetic acid is 54582-01-3.
More information of (R)-(4-hydroxyphenyl)(phenylacetamido)acetic acid 54582-01-3 are:
|
Synonyms |
(R)-(4-Hydroxyphenyl)(phenylacetamido)acetic acid;(2R)-(4-Hydroxyphenyl)[(phenylacetyl)amino]ethanoic acid;(R)-2-(4-Hydroxyphenyl)-2-(phenylacetylamino)acetic acid;(R)-4-Hydroxy-α-[(phenylacetyl)amino]benzeneacetic acid; |
|
CAS?Number |
54582-01-3 |
|
Molecular Formula |
C16H15NO4 |
|
Molecular Weight |
285.299 |
|
Density |
1.322 g/cm3 |
|
Boiling Point |
594 °C at 760 mmHg |
|
Flash Point |
313 °C |
|
HS CODE |
2924299090 |
|
PSA |
90.12000 |
|
LogP |
2.71710 |
What is (R)-(4-hydroxyphenyl)(phenylacetamido)acetic acid (54582-01-3) used for?
(R)-(4-hydroxyphenyl)(phenylacetamido)acetic acid is a chiral chemical compound characterized by its molecular structure, which features a phenylacetamido group and a 4-hydroxyphenyl group attached to an acetic acid molecule. (R)-(4-hydroxyphenyl)(phenylacetamido)acetic acid's stereochemistry is denoted as (R), which specifies the configuration of its chiral center. The presence of phenylacetamido and 4-hydroxyphenyl groups, commonly found in various medications and natural compounds, suggests that (R)-(4-hydroxyphenyl)(phenylacetamido)acetic acid may possess pharmacological or biological activities. Further research and analysis are required to ascertain its exact properties and potential applications.
InChI:InChI=1/C16H15NO4/c18-13-8-6-12(7-9-13)15(16(20)21)17-14(19)10-11-4-2-1-3-5-11/h1-9,15,18H,10H2,(H,17,19)(H,20,21)/t15-/m1/s1
Articles related to (R)-(4-hydroxyphenyl)(phenylacetamido)acetic acid:
|
Article |
Source |
|
One-pot, regioselective synthesis of substituted arylglycines for kinetic resolution by penicillin G acylase |
Grundmann, Peter,Fessner, Wolf-Dieter experimental part, p. 1729 - 1735 (2009/07/24) |
How to get the best price on (R)-(4-hydroxyphenyl)(phenylacetamido)acetic acid?
HUBEI AOSINA CHEM-TECH CO.,LTD is a quality supplier and manufacturer of (R)-(4-hydroxyphenyl)(phenylacetamido)acetic acid . You can buy high quality, low price (R)-(4-hydroxyphenyl)(phenylacetamido)acetic acid 54582-01-3 here. Contact us.
